C24H32F5N3O4 — CID 174754040
tert-butyl 2-[(4,4-difluorocyclohexyl)-(2,2,2-trifluoroacetyl)amino]-4-(4-methylpiperazin-1-yl)benzenecarboperoxoate (PubChem CID 174754040) has the molecular formula C24H32F5N3O4 and a molecular weight of 521.53 g/mol. Its IUPAC name is tert-butyl 2-[(4,4-difluorocyclohexyl)-(2,2,2-trifluoroacetyl)amino]-4-(4-methylpiperazin-1-yl)benzenecarboperoxoate.
| Compound Name | tert-butyl 2-[(4,4-difluorocyclohexyl)-(2,2,2-trifluoroacetyl)amino]-4-(4-methylpiperazin-1-yl)benzenecarboperoxoate |
|---|---|
| PubChem CID | 174754040 |
| Molecular Formula | C24H32F5N3O4 |
| Molecular Weight | 521.53 g/mol |
| Exact Mass | 521.23 |
| IUPAC Name | tert-butyl 2-[(4,4-difluorocyclohexyl)-(2,2,2-trifluoroacetyl)amino]-4-(4-methylpiperazin-1-yl)benzenecarboperoxoate |
| SMILES | CN1CCN(c2ccc(C(=O)OOC(C)(C)C)c(N(C(=O)C(F)(F)F)C3CCC(F)(F)CC3)c2)CC1 |
| InChI | InChI=1S/C24H32F5N3O4/c1-22(2,3)36-35-20(33)18-6-5-17(31-13-11-30(4)12-14-31)15-19(18)32(21(34)24(27,28)29)16-7-9-23(25,26)10-8-16/h5-6,15-16H,7-14H2,1-4H3 |
| InChIKey | SYQSQOSQGLILTC-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.53 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|