C33H35F5N6O3 — CID 163482863
N-[2-amino-5-[(3,5-difluorophenyl)methyl]benzenecarboximidoyl]-4-(4-methylpiperazin-1-yl)-2-[oxan-4-yl-(2,2,2-trifluoroacetyl)amino]benzamide (PubChem CID 163482863) has the molecular formula C33H35F5N6O3 and a molecular weight of 658.67 g/mol. Its IUPAC name is N-[2-amino-5-[(3,5-difluorophenyl)methyl]benzenecarboximidoyl]-4-(4-methylpiperazin-1-yl)-2-[oxan-4-yl-(2,2,2-trifluoroacetyl)amino]benzamide.
| Compound Name | N-[2-amino-5-[(3,5-difluorophenyl)methyl]benzenecarboximidoyl]-4-(4-methylpiperazin-1-yl)-2-[oxan-4-yl-(2,2,2-trifluoroacetyl)amino]benzamide |
|---|---|
| PubChem CID | 163482863 |
| Molecular Formula | C33H35F5N6O3 |
| Molecular Weight | 658.67 g/mol |
| Exact Mass | 658.27 |
| IUPAC Name | N-[2-amino-5-[(3,5-difluorophenyl)methyl]benzenecarboximidoyl]-4-(4-methylpiperazin-1-yl)-2-[oxan-4-yl-(2,2,2-trifluoroacetyl)amino]benzamide |
| SMILES | [H]/N=C(/NC(=O)c1ccc(N2CCN(C)CC2)cc1N(C(=O)C(F)(F)F)C1CCOCC1)c1cc(Cc2cc(F)cc(F)c2)ccc1N |
| InChI | InChI=1S/C33H35F5N6O3/c1-42-8-10-43(11-9-42)25-3-4-26(29(19-25)44(32(46)33(36,37)38)24-6-12-47-13-7-24)31(45)41-30(40)27-17-20(2-5-28(27)39)14-21-15-22(34)18-23(35)16-21/h2-5,15-19,24H,6-14,39H2,1H3,(H2,40,41,45) |
| InChIKey | CGBVWWWIQYZXGI-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.67 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|