C51H45F5N6O5S — CID 86643843
N-[5-(3,5-difluorophenyl)sulfonyl-1-tritylindazol-3-yl]-4-(4-methylpiperazin-1-yl)-2-[oxan-4-yl-(2,2,2-trifluoroacetyl)amino]benzamide (PubChem CID 86643843) has the molecular formula C51H45F5N6O5S and a molecular weight of 949.02 g/mol. Its IUPAC name is N-[5-(3,5-difluorophenyl)sulfonyl-1-tritylindazol-3-yl]-4-(4-methylpiperazin-1-yl)-2-[oxan-4-yl-(2,2,2-trifluoroacetyl)amino]benzamide.
| Compound Name | N-[5-(3,5-difluorophenyl)sulfonyl-1-tritylindazol-3-yl]-4-(4-methylpiperazin-1-yl)-2-[oxan-4-yl-(2,2,2-trifluoroacetyl)amino]benzamide |
|---|---|
| PubChem CID | 86643843 |
| Molecular Formula | C51H45F5N6O5S |
| Molecular Weight | 949.02 g/mol |
| Exact Mass | 948.31 |
| IUPAC Name | N-[5-(3,5-difluorophenyl)sulfonyl-1-tritylindazol-3-yl]-4-(4-methylpiperazin-1-yl)-2-[oxan-4-yl-(2,2,2-trifluoroacetyl)amino]benzamide |
| SMILES | CN1CCN(c2ccc(C(=O)Nc3nn(C(c4ccccc4)(c4ccccc4)c4ccccc4)c4ccc(S(=O)(=O)c5cc(F)cc(F)c5)cc34)c(N(C(=O)C(F)(F)F)C3CCOCC3)c2)CC1 |
| InChI | InChI=1S/C51H45F5N6O5S/c1-59-23-25-60(26-24-59)40-17-19-43(46(32-40)61(49(64)51(54,55)56)39-21-27-67-28-22-39)48(63)57-47-44-33-41(68(65,66)42-30-37(52)29-38(53)31-42)18-20-45(44)62(58-47)50(34-11-5-2-6-12-34,35-13-7-3-8-14-35)36-15-9-4-10-16-36/h2-20,29-33,39H,21-28H2,1H3,(H,57,58,63) |
| InChIKey | QGNXMQLHUUZJCS-UHFFFAOYSA-N |
| XLogP | 9.07 |
| TPSA | 117.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 949.02 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|