C44H37FN6O5S — CID 174597709
N-[5-(3-fluorophenyl)sulfonyl-1-tritylindazol-3-yl]-3-(4-methylpiperazin-1-yl)-2-nitrobenzamide (PubChem CID 174597709) has the molecular formula C44H37FN6O5S and a molecular weight of 780.88 g/mol. Its IUPAC name is N-[5-(3-fluorophenyl)sulfonyl-1-tritylindazol-3-yl]-3-(4-methylpiperazin-1-yl)-2-nitrobenzamide.
| Compound Name | N-[5-(3-fluorophenyl)sulfonyl-1-tritylindazol-3-yl]-3-(4-methylpiperazin-1-yl)-2-nitrobenzamide |
|---|---|
| PubChem CID | 174597709 |
| Molecular Formula | C44H37FN6O5S |
| Molecular Weight | 780.88 g/mol |
| Exact Mass | 780.25 |
| IUPAC Name | N-[5-(3-fluorophenyl)sulfonyl-1-tritylindazol-3-yl]-3-(4-methylpiperazin-1-yl)-2-nitrobenzamide |
| SMILES | CN1CCN(c2cccc(C(=O)Nc3nn(C(c4ccccc4)(c4ccccc4)c4ccccc4)c4ccc(S(=O)(=O)c5cccc(F)c5)cc34)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C44H37FN6O5S/c1-48-25-27-49(28-26-48)40-22-12-21-37(41(40)51(53)54)43(52)46-42-38-30-36(57(55,56)35-20-11-19-34(45)29-35)23-24-39(38)50(47-42)44(31-13-5-2-6-14-31,32-15-7-3-8-16-32)33-17-9-4-10-18-33/h2-24,29-30H,25-28H2,1H3,(H,46,47,52) |
| InChIKey | OBCLDAWRSPUJBJ-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 130.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.88 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|