C39H35FN4O — CID 169208403
N-[5-(4-fluorophenyl)-1-tritylindazol-3-yl]-1-methylpiperidine-4-carboxamide (PubChem CID 169208403) has the molecular formula C39H35FN4O and a molecular weight of 594.73 g/mol. Its IUPAC name is N-[5-(4-fluorophenyl)-1-tritylindazol-3-yl]-1-methylpiperidine-4-carboxamide.
| Compound Name | N-[5-(4-fluorophenyl)-1-tritylindazol-3-yl]-1-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 169208403 |
| Molecular Formula | C39H35FN4O |
| Molecular Weight | 594.73 g/mol |
| Exact Mass | 594.28 |
| IUPAC Name | N-[5-(4-fluorophenyl)-1-tritylindazol-3-yl]-1-methylpiperidine-4-carboxamide |
| SMILES | CN1CCC(C(=O)Nc2nn(C(c3ccccc3)(c3ccccc3)c3ccccc3)c3ccc(-c4ccc(F)cc4)cc23)CC1 |
| InChI | InChI=1S/C39H35FN4O/c1-43-25-23-29(24-26-43)38(45)41-37-35-27-30(28-17-20-34(40)21-18-28)19-22-36(35)44(42-37)39(31-11-5-2-6-12-31,32-13-7-3-8-14-32)33-15-9-4-10-16-33/h2-22,27,29H,23-26H2,1H3,(H,41,42,45) |
| InChIKey | LCRSDYSBVKLZIL-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.73 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|