C39H42N4O4 — CID 169208507
tert-butyl (3R)-3-[(5-ethoxy-1-tritylindazol-3-yl)carbamoyl]piperidine-1-carboxylate (PubChem CID 169208507) has the molecular formula C39H42N4O4 and a molecular weight of 630.79 g/mol. Its IUPAC name is tert-butyl (3R)-3-[(5-ethoxy-1-tritylindazol-3-yl)carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[(5-ethoxy-1-tritylindazol-3-yl)carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 169208507 |
| Molecular Formula | C39H42N4O4 |
| Molecular Weight | 630.79 g/mol |
| Exact Mass | 630.32 |
| IUPAC Name | tert-butyl (3R)-3-[(5-ethoxy-1-tritylindazol-3-yl)carbamoyl]piperidine-1-carboxylate |
| SMILES | CCOc1ccc2c(c1)c(NC(=O)[C@@H]1CCCN(C(=O)OC(C)(C)C)C1)nn2C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C39H42N4O4/c1-5-46-32-23-24-34-33(26-32)35(40-36(44)28-16-15-25-42(27-28)37(45)47-38(2,3)4)41-43(34)39(29-17-9-6-10-18-29,30-19-11-7-12-20-30)31-21-13-8-14-22-31/h6-14,17-24,26,28H,5,15-16,25,27H2,1-4H3,(H,40,41,44)/t28-/m1/s1 |
| InChIKey | YWRIZKUXELXDCE-MUUNZHRXSA-N |
| XLogP | 7.86 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.79 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|