C39H33ClN4O4 — CID 170170441
(3R)-3-[[5-(2-chloro-4-hydroxyphenyl)-1-tritylindazol-3-yl]carbamoyl]piperidine-1-carboxylic acid (PubChem CID 170170441) has the molecular formula C39H33ClN4O4 and a molecular weight of 657.17 g/mol. Its IUPAC name is (3R)-3-[[5-(2-chloro-4-hydroxyphenyl)-1-tritylindazol-3-yl]carbamoyl]piperidine-1-carboxylic acid.
| Compound Name | (3R)-3-[[5-(2-chloro-4-hydroxyphenyl)-1-tritylindazol-3-yl]carbamoyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 170170441 |
| Molecular Formula | C39H33ClN4O4 |
| Molecular Weight | 657.17 g/mol |
| Exact Mass | 656.22 |
| IUPAC Name | (3R)-3-[[5-(2-chloro-4-hydroxyphenyl)-1-tritylindazol-3-yl]carbamoyl]piperidine-1-carboxylic acid |
| SMILES | O=C(Nc1nn(C(c2ccccc2)(c2ccccc2)c2ccccc2)c2ccc(-c3ccc(O)cc3Cl)cc12)[C@@H]1CCCN(C(=O)O)C1 |
| InChI | InChI=1S/C39H33ClN4O4/c40-34-24-31(45)19-20-32(34)26-18-21-35-33(23-26)36(41-37(46)27-11-10-22-43(25-27)38(47)48)42-44(35)39(28-12-4-1-5-13-28,29-14-6-2-7-15-29)30-16-8-3-9-17-30/h1-9,12-21,23-24,27,45H,10-11,22,25H2,(H,47,48)(H,41,42,46)/t27-/m1/s1 |
| InChIKey | HQURSPWNTDDHEN-HHHXNRCGSA-N |
| XLogP | 8.23 |
| TPSA | 107.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.17 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|