C39H34Cl2N4O — CID 169207808
N-[5-(2,6-dichlorophenyl)-1-tritylindazol-3-yl]-1-methylpiperidine-4-carboxamide (PubChem CID 169207808) has the molecular formula C39H34Cl2N4O and a molecular weight of 645.63 g/mol. Its IUPAC name is N-[5-(2,6-dichlorophenyl)-1-tritylindazol-3-yl]-1-methylpiperidine-4-carboxamide.
| Compound Name | N-[5-(2,6-dichlorophenyl)-1-tritylindazol-3-yl]-1-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 169207808 |
| Molecular Formula | C39H34Cl2N4O |
| Molecular Weight | 645.63 g/mol |
| Exact Mass | 644.21 |
| IUPAC Name | N-[5-(2,6-dichlorophenyl)-1-tritylindazol-3-yl]-1-methylpiperidine-4-carboxamide |
| SMILES | CN1CCC(C(=O)Nc2nn(C(c3ccccc3)(c3ccccc3)c3ccccc3)c3ccc(-c4c(Cl)cccc4Cl)cc23)CC1 |
| InChI | InChI=1S/C39H34Cl2N4O/c1-44-24-22-27(23-25-44)38(46)42-37-32-26-28(36-33(40)18-11-19-34(36)41)20-21-35(32)45(43-37)39(29-12-5-2-6-13-29,30-14-7-3-8-15-30)31-16-9-4-10-17-31/h2-21,26-27H,22-25H2,1H3,(H,42,43,46) |
| InChIKey | AQSJDCQXYFJRNV-UHFFFAOYSA-N |
| XLogP | 9.13 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.63 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|