C32H29BrN4O — CID 169207806
N-(5-bromo-1-tritylindazol-3-yl)piperidine-4-carboxamide (PubChem CID 169207806) has the molecular formula C32H29BrN4O and a molecular weight of 565.52 g/mol. Its IUPAC name is N-(5-bromo-1-tritylindazol-3-yl)piperidine-4-carboxamide.
| Compound Name | N-(5-bromo-1-tritylindazol-3-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 169207806 |
| Molecular Formula | C32H29BrN4O |
| Molecular Weight | 565.52 g/mol |
| Exact Mass | 564.15 |
| IUPAC Name | N-(5-bromo-1-tritylindazol-3-yl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1nn(C(c2ccccc2)(c2ccccc2)c2ccccc2)c2ccc(Br)cc12)C1CCNCC1 |
| InChI | InChI=1S/C32H29BrN4O/c33-27-16-17-29-28(22-27)30(35-31(38)23-18-20-34-21-19-23)36-37(29)32(24-10-4-1-5-11-24,25-12-6-2-7-13-25)26-14-8-3-9-15-26/h1-17,22-23,34H,18-21H2,(H,35,36,38) |
| InChIKey | HNWUUPGZUJIEMI-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.52 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|