C32H29BrN4O — CID 169207989
N-(5-bromo-1-tritylindazol-3-yl)-3-(methylamino)cyclobutane-1-carboxamide (PubChem CID 169207989) has the molecular formula C32H29BrN4O and a molecular weight of 565.52 g/mol. Its IUPAC name is N-(5-bromo-1-tritylindazol-3-yl)-3-(methylamino)cyclobutane-1-carboxamide.
| Compound Name | N-(5-bromo-1-tritylindazol-3-yl)-3-(methylamino)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 169207989 |
| Molecular Formula | C32H29BrN4O |
| Molecular Weight | 565.52 g/mol |
| Exact Mass | 564.15 |
| IUPAC Name | N-(5-bromo-1-tritylindazol-3-yl)-3-(methylamino)cyclobutane-1-carboxamide |
| SMILES | CNC1CC(C(=O)Nc2nn(C(c3ccccc3)(c3ccccc3)c3ccccc3)c3ccc(Br)cc23)C1 |
| InChI | InChI=1S/C32H29BrN4O/c1-34-27-19-22(20-27)31(38)35-30-28-21-26(33)17-18-29(28)37(36-30)32(23-11-5-2-6-12-23,24-13-7-3-8-14-24)25-15-9-4-10-16-25/h2-18,21-22,27,34H,19-20H2,1H3,(H,35,36,38) |
| InChIKey | XWWNIXIWIBHWQA-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.52 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|