C40H32ClN5O3 — CID 170170822
(3R)-3-[[5-(2-chloro-5-cyanophenyl)-1-tritylindazol-3-yl]carbamoyl]piperidine-1-carboxylic acid (PubChem CID 170170822) has the molecular formula C40H32ClN5O3 and a molecular weight of 666.18 g/mol. Its IUPAC name is (3R)-3-[[5-(2-chloro-5-cyanophenyl)-1-tritylindazol-3-yl]carbamoyl]piperidine-1-carboxylic acid.
| Compound Name | (3R)-3-[[5-(2-chloro-5-cyanophenyl)-1-tritylindazol-3-yl]carbamoyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 170170822 |
| Molecular Formula | C40H32ClN5O3 |
| Molecular Weight | 666.18 g/mol |
| Exact Mass | 665.22 |
| IUPAC Name | (3R)-3-[[5-(2-chloro-5-cyanophenyl)-1-tritylindazol-3-yl]carbamoyl]piperidine-1-carboxylic acid |
| SMILES | N#Cc1ccc(Cl)c(-c2ccc3c(c2)c(NC(=O)[C@@H]2CCCN(C(=O)O)C2)nn3C(c2ccccc2)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C40H32ClN5O3/c41-35-20-18-27(25-42)23-33(35)28-19-21-36-34(24-28)37(43-38(47)29-11-10-22-45(26-29)39(48)49)44-46(36)40(30-12-4-1-5-13-30,31-14-6-2-7-15-31)32-16-8-3-9-17-32/h1-9,12-21,23-24,29H,10-11,22,26H2,(H,48,49)(H,43,44,47)/t29-/m1/s1 |
| InChIKey | ZCTNDUYQLNVSHW-GDLZYMKVSA-N |
| XLogP | 8.40 |
| TPSA | 111.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.18 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|