C43H42ClN5O3 — CID 169207941
tert-butyl (3R)-3-[[5-(4-amino-2-chlorophenyl)-1-tritylindazol-3-yl]carbamoyl]piperidine-1-carboxylate (PubChem CID 169207941) has the molecular formula C43H42ClN5O3 and a molecular weight of 712.29 g/mol. Its IUPAC name is tert-butyl (3R)-3-[[5-(4-amino-2-chlorophenyl)-1-tritylindazol-3-yl]carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[[5-(4-amino-2-chlorophenyl)-1-tritylindazol-3-yl]carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 169207941 |
| Molecular Formula | C43H42ClN5O3 |
| Molecular Weight | 712.29 g/mol |
| Exact Mass | 711.30 |
| IUPAC Name | tert-butyl (3R)-3-[[5-(4-amino-2-chlorophenyl)-1-tritylindazol-3-yl]carbamoyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](C(=O)Nc2nn(C(c3ccccc3)(c3ccccc3)c3ccccc3)c3ccc(-c4ccc(N)cc4Cl)cc23)C1 |
| InChI | InChI=1S/C43H42ClN5O3/c1-42(2,3)52-41(51)48-25-13-14-30(28-48)40(50)46-39-36-26-29(35-23-22-34(45)27-37(35)44)21-24-38(36)49(47-39)43(31-15-7-4-8-16-31,32-17-9-5-10-18-32)33-19-11-6-12-20-33/h4-12,15-24,26-27,30H,13-14,25,28,45H2,1-3H3,(H,46,47,50)/t30-/m1/s1 |
| InChIKey | RXUYDGKSSLSFMT-SSEXGKCCSA-N |
| XLogP | 9.36 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.29 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|