C43H43ClN4O4 — CID 169208146
tert-butyl piperidine-1-carboxylate;N-[5-(2-chloro-4-hydroxyphenyl)-1-tritylindazol-3-yl]formamide (PubChem CID 169208146) has the molecular formula C43H43ClN4O4 and a molecular weight of 715.29 g/mol. Its IUPAC name is tert-butyl piperidine-1-carboxylate;N-[5-(2-chloro-4-hydroxyphenyl)-1-tritylindazol-3-yl]formamide.
| Compound Name | tert-butyl piperidine-1-carboxylate;N-[5-(2-chloro-4-hydroxyphenyl)-1-tritylindazol-3-yl]formamide |
|---|---|
| PubChem CID | 169208146 |
| Molecular Formula | C43H43ClN4O4 |
| Molecular Weight | 715.29 g/mol |
| Exact Mass | 714.30 |
| IUPAC Name | tert-butyl piperidine-1-carboxylate;N-[5-(2-chloro-4-hydroxyphenyl)-1-tritylindazol-3-yl]formamide |
| SMILES | CC(C)(C)OC(=O)N1CCCCC1.O=CNc1nn(C(c2ccccc2)(c2ccccc2)c2ccccc2)c2ccc(-c3ccc(O)cc3Cl)cc12 |
| InChI | InChI=1S/C33H24ClN3O2.C10H19NO2/c34-30-21-27(39)17-18-28(30)23-16-19-31-29(20-23)32(35-22-38)36-37(31)33(24-10-4-1-5-11-24,25-12-6-2-7-13-25)26-14-8-3-9-15-26;1-10(2,3)13-9(12)11-7-5-4-6-8-11/h1-22,39H,(H,35,36,38);4-8H2,1-3H3 |
| InChIKey | VXIHOJAKQIAIBQ-UHFFFAOYSA-N |
| XLogP | 9.88 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.29 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|