C14H10ClN3O2 — CID 169208039
N-[5-(2-chloro-4-hydroxyphenyl)-1H-indazol-3-yl]formamide (PubChem CID 169208039) has the molecular formula C14H10ClN3O2 and a molecular weight of 287.71 g/mol. Its IUPAC name is N-[5-(2-chloro-4-hydroxyphenyl)-1H-indazol-3-yl]formamide.
| Compound Name | N-[5-(2-chloro-4-hydroxyphenyl)-1H-indazol-3-yl]formamide |
|---|---|
| PubChem CID | 169208039 |
| Molecular Formula | C14H10ClN3O2 |
| Molecular Weight | 287.71 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | N-[5-(2-chloro-4-hydroxyphenyl)-1H-indazol-3-yl]formamide |
| SMILES | O=CNc1n[nH]c2ccc(-c3ccc(O)cc3Cl)cc12 |
| InChI | InChI=1S/C14H10ClN3O2/c15-12-6-9(20)2-3-10(12)8-1-4-13-11(5-8)14(16-7-19)18-17-13/h1-7,20H,(H2,16,17,18,19) |
| InChIKey | VABTXPQCKOFYIA-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.71 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|