C19H22Cl3N5O — CID 169208126
(3R)-N-[5-(4-amino-2-chlorophenyl)-1H-indazol-3-yl]piperidine-3-carboxamide;dihydrochloride (PubChem CID 169208126) has the molecular formula C19H22Cl3N5O and a molecular weight of 442.78 g/mol. Its IUPAC name is (3R)-N-[5-(4-amino-2-chlorophenyl)-1H-indazol-3-yl]piperidine-3-carboxamide;dihydrochloride.
| Compound Name | (3R)-N-[5-(4-amino-2-chlorophenyl)-1H-indazol-3-yl]piperidine-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 169208126 |
| Molecular Formula | C19H22Cl3N5O |
| Molecular Weight | 442.78 g/mol |
| Exact Mass | 441.09 |
| IUPAC Name | (3R)-N-[5-(4-amino-2-chlorophenyl)-1H-indazol-3-yl]piperidine-3-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.Nc1ccc(-c2ccc3[nH]nc(NC(=O)[C@@H]4CCCNC4)c3c2)c(Cl)c1 |
| InChI | InChI=1S/C19H20ClN5O.2ClH/c20-16-9-13(21)4-5-14(16)11-3-6-17-15(8-11)18(25-24-17)23-19(26)12-2-1-7-22-10-12;;/h3-6,8-9,12,22H,1-2,7,10,21H2,(H2,23,24,25,26);2*1H/t12-;;/m1../s1 |
| InChIKey | LXRRXWBFRBNMJA-CURYUGHLSA-N |
| XLogP | 4.25 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.78 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|