C21H27Cl2N5O — CID 169208379
N-[5-(4-amino-2-methylphenyl)-1H-indazol-3-yl]-1-methylpiperidine-4-carboxamide;dihydrochloride (PubChem CID 169208379) has the molecular formula C21H27Cl2N5O and a molecular weight of 436.39 g/mol. Its IUPAC name is N-[5-(4-amino-2-methylphenyl)-1H-indazol-3-yl]-1-methylpiperidine-4-carboxamide;dihydrochloride.
| Compound Name | N-[5-(4-amino-2-methylphenyl)-1H-indazol-3-yl]-1-methylpiperidine-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 169208379 |
| Molecular Formula | C21H27Cl2N5O |
| Molecular Weight | 436.39 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | N-[5-(4-amino-2-methylphenyl)-1H-indazol-3-yl]-1-methylpiperidine-4-carboxamide;dihydrochloride |
| SMILES | Cc1cc(N)ccc1-c1ccc2[nH]nc(NC(=O)C3CCN(C)CC3)c2c1.Cl.Cl |
| InChI | InChI=1S/C21H25N5O.2ClH/c1-13-11-16(22)4-5-17(13)15-3-6-19-18(12-15)20(25-24-19)23-21(27)14-7-9-26(2)10-8-14;;/h3-6,11-12,14H,7-10,22H2,1-2H3,(H2,23,24,25,27);2*1H |
| InChIKey | DAYFFPQIJHPASC-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.39 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|