C22H21ClF3N5O5 — CID 170170455
N-[5-(2-chloro-5-nitrophenyl)-1H-indazol-3-yl]-1-methylpiperidine-4-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 170170455) has the molecular formula C22H21ClF3N5O5 and a molecular weight of 527.89 g/mol. Its IUPAC name is N-[5-(2-chloro-5-nitrophenyl)-1H-indazol-3-yl]-1-methylpiperidine-4-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[5-(2-chloro-5-nitrophenyl)-1H-indazol-3-yl]-1-methylpiperidine-4-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 170170455 |
| Molecular Formula | C22H21ClF3N5O5 |
| Molecular Weight | 527.89 g/mol |
| Exact Mass | 527.12 |
| IUPAC Name | N-[5-(2-chloro-5-nitrophenyl)-1H-indazol-3-yl]-1-methylpiperidine-4-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CN1CCC(C(=O)Nc2n[nH]c3ccc(-c4cc([N+](=O)[O-])ccc4Cl)cc23)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H20ClN5O3.C2HF3O2/c1-25-8-6-12(7-9-25)20(27)22-19-16-10-13(2-5-18(16)23-24-19)15-11-14(26(28)29)3-4-17(15)21;3-2(4,5)1(6)7/h2-5,10-12H,6-9H2,1H3,(H2,22,23,24,27);(H,6,7) |
| InChIKey | XLTGBWWZKYKCDC-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 141.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.89 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|