C19H18Cl2N4O — CID 169207900
(3R)-N-[5-(2,4-dichlorophenyl)-1H-indazol-3-yl]piperidine-3-carboxamide (PubChem CID 169207900) has the molecular formula C19H18Cl2N4O and a molecular weight of 389.29 g/mol. Its IUPAC name is (3R)-N-[5-(2,4-dichlorophenyl)-1H-indazol-3-yl]piperidine-3-carboxamide.
| Compound Name | (3R)-N-[5-(2,4-dichlorophenyl)-1H-indazol-3-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 169207900 |
| Molecular Formula | C19H18Cl2N4O |
| Molecular Weight | 389.29 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | (3R)-N-[5-(2,4-dichlorophenyl)-1H-indazol-3-yl]piperidine-3-carboxamide |
| SMILES | O=C(Nc1n[nH]c2ccc(-c3ccc(Cl)cc3Cl)cc12)[C@@H]1CCCNC1 |
| InChI | InChI=1S/C19H18Cl2N4O/c20-13-4-5-14(16(21)9-13)11-3-6-17-15(8-11)18(25-24-17)23-19(26)12-2-1-7-22-10-12/h3-6,8-9,12,22H,1-2,7,10H2,(H2,23,24,25,26)/t12-/m1/s1 |
| InChIKey | YZWAYQZWZZBQGS-GFCCVEGCSA-N |
| XLogP | 4.47 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.29 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |