C16H15N3O3 — CID 175394496
N-[6-(3,5-dimethoxyphenyl)-1H-indazol-3-yl]formamide (PubChem CID 175394496) has the molecular formula C16H15N3O3 and a molecular weight of 297.31 g/mol. Its IUPAC name is N-[6-(3,5-dimethoxyphenyl)-1H-indazol-3-yl]formamide.
| Compound Name | N-[6-(3,5-dimethoxyphenyl)-1H-indazol-3-yl]formamide |
|---|---|
| PubChem CID | 175394496 |
| Molecular Formula | C16H15N3O3 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | N-[6-(3,5-dimethoxyphenyl)-1H-indazol-3-yl]formamide |
| SMILES | COc1cc(OC)cc(-c2ccc3c(NC=O)n[nH]c3c2)c1 |
| InChI | InChI=1S/C16H15N3O3/c1-21-12-5-11(6-13(8-12)22-2)10-3-4-14-15(7-10)18-19-16(14)17-9-20/h3-9H,1-2H3,(H2,17,18,19,20) |
| InChIKey | UHAJHKQRKVJQQQ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|