C19H20N4O4 — CID 162663710
N'-hydroxy-N-[6-(3-methoxyphenyl)-1H-indazol-3-yl]pentanediamide (PubChem CID 162663710) has the molecular formula C19H20N4O4 and a molecular weight of 368.39 g/mol. Its IUPAC name is N'-hydroxy-N-[6-(3-methoxyphenyl)-1H-indazol-3-yl]pentanediamide.
| Compound Name | N'-hydroxy-N-[6-(3-methoxyphenyl)-1H-indazol-3-yl]pentanediamide |
|---|---|
| PubChem CID | 162663710 |
| Molecular Formula | C19H20N4O4 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | N'-hydroxy-N-[6-(3-methoxyphenyl)-1H-indazol-3-yl]pentanediamide |
| SMILES | COc1cccc(-c2ccc3c(NC(=O)CCCC(=O)NO)n[nH]c3c2)c1 |
| InChI | InChI=1S/C19H20N4O4/c1-27-14-5-2-4-12(10-14)13-8-9-15-16(11-13)21-22-19(15)20-17(24)6-3-7-18(25)23-26/h2,4-5,8-11,26H,3,6-7H2,1H3,(H,23,25)(H2,20,21,22,24) |
| InChIKey | CWVHTMDIWNFNQO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 116.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|