C45H41ClN6O4 — CID 169208590
tert-butyl (3R)-3-[[5-[2-chloro-5-(1,2,4-oxadiazol-3-yl)phenyl]-1-tritylindazol-3-yl]carbamoyl]piperidine-1-carboxylate (PubChem CID 169208590) has the molecular formula C45H41ClN6O4 and a molecular weight of 765.31 g/mol. Its IUPAC name is tert-butyl (3R)-3-[[5-[2-chloro-5-(1,2,4-oxadiazol-3-yl)phenyl]-1-tritylindazol-3-yl]carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[[5-[2-chloro-5-(1,2,4-oxadiazol-3-yl)phenyl]-1-tritylindazol-3-yl]carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 169208590 |
| Molecular Formula | C45H41ClN6O4 |
| Molecular Weight | 765.31 g/mol |
| Exact Mass | 764.29 |
| IUPAC Name | tert-butyl (3R)-3-[[5-[2-chloro-5-(1,2,4-oxadiazol-3-yl)phenyl]-1-tritylindazol-3-yl]carbamoyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](C(=O)Nc2nn(C(c3ccccc3)(c3ccccc3)c3ccccc3)c3ccc(-c4cc(-c5ncon5)ccc4Cl)cc23)C1 |
| InChI | InChI=1S/C45H41ClN6O4/c1-44(2,3)56-43(54)51-25-13-14-32(28-51)42(53)48-41-37-26-30(36-27-31(21-23-38(36)46)40-47-29-55-50-40)22-24-39(37)52(49-41)45(33-15-7-4-8-16-33,34-17-9-5-10-18-34)35-19-11-6-12-20-35/h4-12,15-24,26-27,29,32H,13-14,25,28H2,1-3H3,(H,48,49,53)/t32-/m1/s1 |
| InChIKey | QWCKYQZTJRNVPK-JGCGQSQUSA-N |
| XLogP | 9.83 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.31 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|