C43H41ClN5O4- — CID 169208602
tert-butyl (3R)-3-[[5-[2-chloro-5-(oxidoamino)phenyl]-1-tritylindazol-3-yl]carbamoyl]piperidine-1-carboxylate (PubChem CID 169208602) has the molecular formula C43H41ClN5O4- and a molecular weight of 727.29 g/mol. Its IUPAC name is tert-butyl (3R)-3-[[5-[2-chloro-5-(oxidoamino)phenyl]-1-tritylindazol-3-yl]carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[[5-[2-chloro-5-(oxidoamino)phenyl]-1-tritylindazol-3-yl]carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 169208602 |
| Molecular Formula | C43H41ClN5O4- |
| Molecular Weight | 727.29 g/mol |
| Exact Mass | 726.29 |
| IUPAC Name | tert-butyl (3R)-3-[[5-[2-chloro-5-(oxidoamino)phenyl]-1-tritylindazol-3-yl]carbamoyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](C(=O)Nc2nn(C(c3ccccc3)(c3ccccc3)c3ccccc3)c3ccc(-c4cc(N[O-])ccc4Cl)cc23)C1 |
| InChI | InChI=1S/C43H41ClN5O4/c1-42(2,3)53-41(51)48-25-13-14-30(28-48)40(50)45-39-36-26-29(35-27-34(47-52)22-23-37(35)44)21-24-38(36)49(46-39)43(31-15-7-4-8-16-31,32-17-9-5-10-18-32)33-19-11-6-12-20-33/h4-12,15-24,26-27,30,47H,13-14,25,28H2,1-3H3,(H,45,46,50)/q-1/t30-/m1/s1 |
| InChIKey | ANPCGLUUTQZFGL-SSEXGKCCSA-N |
| XLogP | 9.69 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.29 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|