C35H33N5O2 — CID 170248462
tert-butyl 4-[3-(methylamino)-1-tritylindazol-5-yl]pyrazole-1-carboxylate (PubChem CID 170248462) has the molecular formula C35H33N5O2 and a molecular weight of 555.68 g/mol. Its IUPAC name is tert-butyl 4-[3-(methylamino)-1-tritylindazol-5-yl]pyrazole-1-carboxylate.
| Compound Name | tert-butyl 4-[3-(methylamino)-1-tritylindazol-5-yl]pyrazole-1-carboxylate |
|---|---|
| PubChem CID | 170248462 |
| Molecular Formula | C35H33N5O2 |
| Molecular Weight | 555.68 g/mol |
| Exact Mass | 555.26 |
| IUPAC Name | tert-butyl 4-[3-(methylamino)-1-tritylindazol-5-yl]pyrazole-1-carboxylate |
| SMILES | CNc1nn(C(c2ccccc2)(c2ccccc2)c2ccccc2)c2ccc(-c3cnn(C(=O)OC(C)(C)C)c3)cc12 |
| InChI | InChI=1S/C35H33N5O2/c1-34(2,3)42-33(41)39-24-26(23-37-39)25-20-21-31-30(22-25)32(36-4)38-40(31)35(27-14-8-5-9-15-27,28-16-10-6-11-17-28)29-18-12-7-13-19-29/h5-24H,1-4H3,(H,36,38) |
| InChIKey | GRSMPFQEJPYDAY-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 73.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.68 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|