C41H38Cl2N4O — CID 169208467
N-[5-(2,6-dichlorophenyl)-1-tritylindazol-3-yl]-4-(dimethylamino)cyclohexane-1-carboxamide (PubChem CID 169208467) has the molecular formula C41H38Cl2N4O and a molecular weight of 673.69 g/mol. Its IUPAC name is N-[5-(2,6-dichlorophenyl)-1-tritylindazol-3-yl]-4-(dimethylamino)cyclohexane-1-carboxamide.
| Compound Name | N-[5-(2,6-dichlorophenyl)-1-tritylindazol-3-yl]-4-(dimethylamino)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 169208467 |
| Molecular Formula | C41H38Cl2N4O |
| Molecular Weight | 673.69 g/mol |
| Exact Mass | 672.24 |
| IUPAC Name | N-[5-(2,6-dichlorophenyl)-1-tritylindazol-3-yl]-4-(dimethylamino)cyclohexane-1-carboxamide |
| SMILES | CN(C)C1CCC(C(=O)Nc2nn(C(c3ccccc3)(c3ccccc3)c3ccccc3)c3ccc(-c4c(Cl)cccc4Cl)cc23)CC1 |
| InChI | InChI=1S/C41H38Cl2N4O/c1-46(2)33-24-21-28(22-25-33)40(48)44-39-34-27-29(38-35(42)19-12-20-36(38)43)23-26-37(34)47(45-39)41(30-13-6-3-7-14-30,31-15-8-4-9-16-31)32-17-10-5-11-18-32/h3-20,23,26-28,33H,21-22,24-25H2,1-2H3,(H,44,45,48) |
| InChIKey | MXUUMSJVEANBKF-UHFFFAOYSA-N |
| XLogP | 9.91 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.69 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|