C33H25Cl2N3 — CID 170248197
5-(2,6-dichlorophenyl)-N-methyl-1-tritylindazol-3-amine (PubChem CID 170248197) has the molecular formula C33H25Cl2N3 and a molecular weight of 534.49 g/mol. Its IUPAC name is 5-(2,6-dichlorophenyl)-N-methyl-1-tritylindazol-3-amine.
| Compound Name | 5-(2,6-dichlorophenyl)-N-methyl-1-tritylindazol-3-amine |
|---|---|
| PubChem CID | 170248197 |
| Molecular Formula | C33H25Cl2N3 |
| Molecular Weight | 534.49 g/mol |
| Exact Mass | 533.14 |
| IUPAC Name | 5-(2,6-dichlorophenyl)-N-methyl-1-tritylindazol-3-amine |
| SMILES | CNc1nn(C(c2ccccc2)(c2ccccc2)c2ccccc2)c2ccc(-c3c(Cl)cccc3Cl)cc12 |
| InChI | InChI=1S/C33H25Cl2N3/c1-36-32-27-22-23(31-28(34)18-11-19-29(31)35)20-21-30(27)38(37-32)33(24-12-5-2-6-13-24,25-14-7-3-8-15-25)26-16-9-4-10-17-26/h2-22H,1H3,(H,36,37) |
| InChIKey | CFNPUNFGKNZAFY-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.49 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|