C29H26ClF3N4 — CID 158560990
6-chloro-N-(1,1,1-trifluoropropan-2-yl)-1-tritylpyrazolo[4,3-c]pyridin-3-amine;methane (PubChem CID 158560990) has the molecular formula C29H26ClF3N4 and a molecular weight of 523.00 g/mol. Its IUPAC name is 6-chloro-N-(1,1,1-trifluoropropan-2-yl)-1-tritylpyrazolo[4,3-c]pyridin-3-amine;methane.
| Compound Name | 6-chloro-N-(1,1,1-trifluoropropan-2-yl)-1-tritylpyrazolo[4,3-c]pyridin-3-amine;methane |
|---|---|
| PubChem CID | 158560990 |
| Molecular Formula | C29H26ClF3N4 |
| Molecular Weight | 523.00 g/mol |
| Exact Mass | 522.18 |
| IUPAC Name | 6-chloro-N-(1,1,1-trifluoropropan-2-yl)-1-tritylpyrazolo[4,3-c]pyridin-3-amine;methane |
| SMILES | C.CC(Nc1nn(C(c2ccccc2)(c2ccccc2)c2ccccc2)c2cc(Cl)ncc12)C(F)(F)F |
| InChI | InChI=1S/C28H22ClF3N4.CH4/c1-19(28(30,31)32)34-26-23-18-33-25(29)17-24(23)36(35-26)27(20-11-5-2-6-12-20,21-13-7-3-8-14-21)22-15-9-4-10-16-22;/h2-19H,1H3,(H,34,35);1H4 |
| InChIKey | HQWPCEQXQKYLCT-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.00 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|