C26H21ClN4 — CID 118272406
6-chloro-N-methyl-1-tritylpyrazolo[4,3-c]pyridin-3-amine (PubChem CID 118272406) has the molecular formula C26H21ClN4 and a molecular weight of 424.94 g/mol. Its IUPAC name is 6-chloro-N-methyl-1-tritylpyrazolo[4,3-c]pyridin-3-amine.
| Compound Name | 6-chloro-N-methyl-1-tritylpyrazolo[4,3-c]pyridin-3-amine |
|---|---|
| PubChem CID | 118272406 |
| Molecular Formula | C26H21ClN4 |
| Molecular Weight | 424.94 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 6-chloro-N-methyl-1-tritylpyrazolo[4,3-c]pyridin-3-amine |
| SMILES | CNc1nn(C(c2ccccc2)(c2ccccc2)c2ccccc2)c2cc(Cl)ncc12 |
| InChI | InChI=1S/C26H21ClN4/c1-28-25-22-18-29-24(27)17-23(22)31(30-25)26(19-11-5-2-6-12-19,20-13-7-3-8-14-20)21-15-9-4-10-16-21/h2-18H,1H3,(H,28,30) |
| InChIKey | UBBFRNDUMXFLQI-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.94 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|