C28H24ClN3O2 — CID 118272494
6-chloro-3-(2-methoxyethoxy)-1-tritylpyrazolo[4,3-c]pyridine (PubChem CID 118272494) has the molecular formula C28H24ClN3O2 and a molecular weight of 469.97 g/mol. Its IUPAC name is 6-chloro-3-(2-methoxyethoxy)-1-tritylpyrazolo[4,3-c]pyridine.
| Compound Name | 6-chloro-3-(2-methoxyethoxy)-1-tritylpyrazolo[4,3-c]pyridine |
|---|---|
| PubChem CID | 118272494 |
| Molecular Formula | C28H24ClN3O2 |
| Molecular Weight | 469.97 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | 6-chloro-3-(2-methoxyethoxy)-1-tritylpyrazolo[4,3-c]pyridine |
| SMILES | COCCOc1nn(C(c2ccccc2)(c2ccccc2)c2ccccc2)c2cc(Cl)ncc12 |
| InChI | InChI=1S/C28H24ClN3O2/c1-33-17-18-34-27-24-20-30-26(29)19-25(24)32(31-27)28(21-11-5-2-6-12-21,22-13-7-3-8-14-22)23-15-9-4-10-16-23/h2-16,19-20H,17-18H2,1H3 |
| InChIKey | HVEFLEPIPBVSOU-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.97 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|