C30H24ClN5O — CID 118272363
6-chloro-3-methoxy-4-(1-methylpyrazol-3-yl)-1-tritylpyrazolo[4,3-c]pyridine (PubChem CID 118272363) has the molecular formula C30H24ClN5O and a molecular weight of 506.01 g/mol. Its IUPAC name is 6-chloro-3-methoxy-4-(1-methylpyrazol-3-yl)-1-tritylpyrazolo[4,3-c]pyridine.
| Compound Name | 6-chloro-3-methoxy-4-(1-methylpyrazol-3-yl)-1-tritylpyrazolo[4,3-c]pyridine |
|---|---|
| PubChem CID | 118272363 |
| Molecular Formula | C30H24ClN5O |
| Molecular Weight | 506.01 g/mol |
| Exact Mass | 505.17 |
| IUPAC Name | 6-chloro-3-methoxy-4-(1-methylpyrazol-3-yl)-1-tritylpyrazolo[4,3-c]pyridine |
| SMILES | COc1nn(C(c2ccccc2)(c2ccccc2)c2ccccc2)c2cc(Cl)nc(-c3ccn(C)n3)c12 |
| InChI | InChI=1S/C30H24ClN5O/c1-35-19-18-24(33-35)28-27-25(20-26(31)32-28)36(34-29(27)37-2)30(21-12-6-3-7-13-21,22-14-8-4-9-15-22)23-16-10-5-11-17-23/h3-20H,1-2H3 |
| InChIKey | SRBSAZNJBAPJDL-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 57.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.01 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|