C36H33N5O3 — CID 118271830
1-[4-(hydroxymethyl)-3-methoxy-1-tritylpyrazolo[4,3-c]pyridin-6-yl]-3-(1-phenylethyl)urea (PubChem CID 118271830) has the molecular formula C36H33N5O3 and a molecular weight of 583.69 g/mol. Its IUPAC name is 1-[4-(hydroxymethyl)-3-methoxy-1-tritylpyrazolo[4,3-c]pyridin-6-yl]-3-(1-phenylethyl)urea.
| Compound Name | 1-[4-(hydroxymethyl)-3-methoxy-1-tritylpyrazolo[4,3-c]pyridin-6-yl]-3-(1-phenylethyl)urea |
|---|---|
| PubChem CID | 118271830 |
| Molecular Formula | C36H33N5O3 |
| Molecular Weight | 583.69 g/mol |
| Exact Mass | 583.26 |
| IUPAC Name | 1-[4-(hydroxymethyl)-3-methoxy-1-tritylpyrazolo[4,3-c]pyridin-6-yl]-3-(1-phenylethyl)urea |
| SMILES | COc1nn(C(c2ccccc2)(c2ccccc2)c2ccccc2)c2cc(NC(=O)NC(C)c3ccccc3)nc(CO)c12 |
| InChI | InChI=1S/C36H33N5O3/c1-25(26-15-7-3-8-16-26)37-35(43)39-32-23-31-33(30(24-42)38-32)34(44-2)40-41(31)36(27-17-9-4-10-18-27,28-19-11-5-12-20-28)29-21-13-6-14-22-29/h3-23,25,42H,24H2,1-2H3,(H2,37,38,39,43) |
| InChIKey | SDJRSWBOQRWONG-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.69 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|