C35H31N5O2 — CID 118272012
1-(4-methyl-3-oxo-1-trityl-2H-pyrazolo[4,3-c]pyridin-6-yl)-3-[(1R)-1-phenylethyl]urea (PubChem CID 118272012) has the molecular formula C35H31N5O2 and a molecular weight of 553.67 g/mol. Its IUPAC name is 1-(4-methyl-3-oxo-1-trityl-2H-pyrazolo[4,3-c]pyridin-6-yl)-3-[(1R)-1-phenylethyl]urea.
| Compound Name | 1-(4-methyl-3-oxo-1-trityl-2H-pyrazolo[4,3-c]pyridin-6-yl)-3-[(1R)-1-phenylethyl]urea |
|---|---|
| PubChem CID | 118272012 |
| Molecular Formula | C35H31N5O2 |
| Molecular Weight | 553.67 g/mol |
| Exact Mass | 553.25 |
| IUPAC Name | 1-(4-methyl-3-oxo-1-trityl-2H-pyrazolo[4,3-c]pyridin-6-yl)-3-[(1R)-1-phenylethyl]urea |
| SMILES | Cc1nc(NC(=O)N[C@H](C)c2ccccc2)cc2c1c(=O)[nH]n2C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H31N5O2/c1-24(26-15-7-3-8-16-26)37-34(42)38-31-23-30-32(25(2)36-31)33(41)39-40(30)35(27-17-9-4-10-18-27,28-19-11-5-12-20-28)29-21-13-6-14-22-29/h3-24H,1-2H3,(H,39,41)(H2,36,37,38,42)/t24-/m1/s1 |
| InChIKey | FYAFGBQOCLOIJF-XMMPIXPASA-N |
| XLogP | 6.76 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.67 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|