C15H15N5O — CID 75181326
1-(1-phenylethyl)-3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)urea (PubChem CID 75181326) has the molecular formula C15H15N5O and a molecular weight of 281.32 g/mol. Its IUPAC name is 1-(1-phenylethyl)-3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)urea.
| Compound Name | 1-(1-phenylethyl)-3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)urea |
|---|---|
| PubChem CID | 75181326 |
| Molecular Formula | C15H15N5O |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 1-(1-phenylethyl)-3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)urea |
| SMILES | CC(NC(=O)Nc1cnc2[nH]ccc2n1)c1ccccc1 |
| InChI | InChI=1S/C15H15N5O/c1-10(11-5-3-2-4-6-11)18-15(21)20-13-9-17-14-12(19-13)7-8-16-14/h2-10H,1H3,(H,16,17)(H2,18,19,20,21) |
| InChIKey | JTZWNWSIJYKURO-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |