C16H17N5O — CID 145106159
1-(7-methyl-1H-pyrazolo[3,4-c]pyridin-5-yl)-3-[(1R)-1-phenylethyl]urea (PubChem CID 145106159) has the molecular formula C16H17N5O and a molecular weight of 295.35 g/mol. Its IUPAC name is 1-(7-methyl-1H-pyrazolo[3,4-c]pyridin-5-yl)-3-[(1R)-1-phenylethyl]urea.
| Compound Name | 1-(7-methyl-1H-pyrazolo[3,4-c]pyridin-5-yl)-3-[(1R)-1-phenylethyl]urea |
|---|---|
| PubChem CID | 145106159 |
| Molecular Formula | C16H17N5O |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 1-(7-methyl-1H-pyrazolo[3,4-c]pyridin-5-yl)-3-[(1R)-1-phenylethyl]urea |
| SMILES | Cc1nc(NC(=O)N[C@H](C)c2ccccc2)cc2cn[nH]c12 |
| InChI | InChI=1S/C16H17N5O/c1-10(12-6-4-3-5-7-12)19-16(22)20-14-8-13-9-17-21-15(13)11(2)18-14/h3-10H,1-2H3,(H,17,21)(H2,18,19,20,22)/t10-/m1/s1 |
| InChIKey | NOJWUGADWOGXPP-SNVBAGLBSA-N |
| XLogP | 3.15 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |