C9H8N4O — CID 172683300
N-(5H-pyrrolo[2,3-b]pyrazin-2-yl)prop-2-enamide (PubChem CID 172683300) has the molecular formula C9H8N4O and a molecular weight of 188.19 g/mol. Its IUPAC name is N-(5H-pyrrolo[2,3-b]pyrazin-2-yl)prop-2-enamide.
| Compound Name | N-(5H-pyrrolo[2,3-b]pyrazin-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 172683300 |
| Molecular Formula | C9H8N4O |
| Molecular Weight | 188.19 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | N-(5H-pyrrolo[2,3-b]pyrazin-2-yl)prop-2-enamide |
| SMILES | C=CC(=O)Nc1cnc2[nH]ccc2n1 |
| InChI | InChI=1S/C9H8N4O/c1-2-8(14)13-7-5-11-9-6(12-7)3-4-10-9/h2-5H,1H2,(H,10,11)(H,12,13,14) |
| InChIKey | SREAEHGVCFPXJT-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.19 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|