C19H20N6O2 — CID 123521332
1-(5-acetyl-2,3,5,9-tetrazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-10-yl)-3-(1-phenylethyl)urea (PubChem CID 123521332) has the molecular formula C19H20N6O2 and a molecular weight of 364.41 g/mol. Its IUPAC name is 1-(5-acetyl-2,3,5,9-tetrazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-10-yl)-3-(1-phenylethyl)urea.
| Compound Name | 1-(5-acetyl-2,3,5,9-tetrazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-10-yl)-3-(1-phenylethyl)urea |
|---|---|
| PubChem CID | 123521332 |
| Molecular Formula | C19H20N6O2 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 1-(5-acetyl-2,3,5,9-tetrazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-10-yl)-3-(1-phenylethyl)urea |
| SMILES | CC(=O)N1CCc2nc(NC(=O)NC(C)c3ccccc3)cc3[nH]nc1c23 |
| InChI | InChI=1S/C19H20N6O2/c1-11(13-6-4-3-5-7-13)20-19(27)22-16-10-15-17-14(21-16)8-9-25(12(2)26)18(17)24-23-15/h3-7,10-11H,8-9H2,1-2H3,(H,23,24)(H2,20,21,22,27) |
| InChIKey | ZDEMPTKMUVCMJJ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |