C19H22N6O2 — CID 137029817
1-(2-hydroxy-2-methyl-1-phenylpropyl)-3-(2,3,5,9-tetrazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-10-yl)urea (PubChem CID 137029817) has the molecular formula C19H22N6O2 and a molecular weight of 366.43 g/mol. Its IUPAC name is 1-(2-hydroxy-2-methyl-1-phenylpropyl)-3-(2,3,5,9-tetrazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-10-yl)urea.
| Compound Name | 1-(2-hydroxy-2-methyl-1-phenylpropyl)-3-(2,3,5,9-tetrazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-10-yl)urea |
|---|---|
| PubChem CID | 137029817 |
| Molecular Formula | C19H22N6O2 |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 1-(2-hydroxy-2-methyl-1-phenylpropyl)-3-(2,3,5,9-tetrazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-10-yl)urea |
| SMILES | CC(C)(O)C(NC(=O)Nc1cc2[nH]nc3c2c(n1)CCN3)c1ccccc1 |
| InChI | InChI=1S/C19H22N6O2/c1-19(2,27)16(11-6-4-3-5-7-11)23-18(26)22-14-10-13-15-12(21-14)8-9-20-17(15)25-24-13/h3-7,10,16,27H,8-9H2,1-2H3,(H2,20,24,25)(H2,21,22,23,26) |
| InChIKey | ZZCVCRSOWICASP-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 114.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |