C40H35N7O — CID 118271502
1-(1-phenylethyl)-3-[3-(pyridin-3-ylmethylamino)-1-tritylpyrazolo[4,3-c]pyridin-6-yl]urea (PubChem CID 118271502) has the molecular formula C40H35N7O and a molecular weight of 629.77 g/mol. Its IUPAC name is 1-(1-phenylethyl)-3-[3-(pyridin-3-ylmethylamino)-1-tritylpyrazolo[4,3-c]pyridin-6-yl]urea.
| Compound Name | 1-(1-phenylethyl)-3-[3-(pyridin-3-ylmethylamino)-1-tritylpyrazolo[4,3-c]pyridin-6-yl]urea |
|---|---|
| PubChem CID | 118271502 |
| Molecular Formula | C40H35N7O |
| Molecular Weight | 629.77 g/mol |
| Exact Mass | 629.29 |
| IUPAC Name | 1-(1-phenylethyl)-3-[3-(pyridin-3-ylmethylamino)-1-tritylpyrazolo[4,3-c]pyridin-6-yl]urea |
| SMILES | CC(NC(=O)Nc1cc2c(cn1)c(NCc1cccnc1)nn2C(c1ccccc1)(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H35N7O/c1-29(31-16-6-2-7-17-31)44-39(48)45-37-25-36-35(28-42-37)38(43-27-30-15-14-24-41-26-30)46-47(36)40(32-18-8-3-9-19-32,33-20-10-4-11-21-33)34-22-12-5-13-23-34/h2-26,28-29H,27H2,1H3,(H,43,46)(H2,42,44,45,48) |
| InChIKey | FTDOONPIWGDCOD-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.77 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|