C31H24ClN5O — CID 118272556
6-chloro-3-methoxy-4-(2-methylpyrimidin-4-yl)-1-tritylpyrazolo[4,3-c]pyridine (PubChem CID 118272556) has the molecular formula C31H24ClN5O and a molecular weight of 518.02 g/mol. Its IUPAC name is 6-chloro-3-methoxy-4-(2-methylpyrimidin-4-yl)-1-tritylpyrazolo[4,3-c]pyridine.
| Compound Name | 6-chloro-3-methoxy-4-(2-methylpyrimidin-4-yl)-1-tritylpyrazolo[4,3-c]pyridine |
|---|---|
| PubChem CID | 118272556 |
| Molecular Formula | C31H24ClN5O |
| Molecular Weight | 518.02 g/mol |
| Exact Mass | 517.17 |
| IUPAC Name | 6-chloro-3-methoxy-4-(2-methylpyrimidin-4-yl)-1-tritylpyrazolo[4,3-c]pyridine |
| SMILES | COc1nn(C(c2ccccc2)(c2ccccc2)c2ccccc2)c2cc(Cl)nc(-c3ccnc(C)n3)c12 |
| InChI | InChI=1S/C31H24ClN5O/c1-21-33-19-18-25(34-21)29-28-26(20-27(32)35-29)37(36-30(28)38-2)31(22-12-6-3-7-13-22,23-14-8-4-9-15-23)24-16-10-5-11-17-24/h3-20H,1-2H3 |
| InChIKey | PCIWSQIXECYXEI-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.02 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|