C39H37N5O3 — CID 66825310
4-[6-[4-(oxan-4-yloxy)-1-tritylpyrazolo[4,3-c]pyridin-3-yl]-2-pyridinyl]morpholine (PubChem CID 66825310) has the molecular formula C39H37N5O3 and a molecular weight of 623.76 g/mol. Its IUPAC name is 4-[6-[4-(oxan-4-yloxy)-1-tritylpyrazolo[4,3-c]pyridin-3-yl]-2-pyridinyl]morpholine.
| Compound Name | 4-[6-[4-(oxan-4-yloxy)-1-tritylpyrazolo[4,3-c]pyridin-3-yl]-2-pyridinyl]morpholine |
|---|---|
| PubChem CID | 66825310 |
| Molecular Formula | C39H37N5O3 |
| Molecular Weight | 623.76 g/mol |
| Exact Mass | 623.29 |
| IUPAC Name | 4-[6-[4-(oxan-4-yloxy)-1-tritylpyrazolo[4,3-c]pyridin-3-yl]-2-pyridinyl]morpholine |
| SMILES | c1ccc(C(c2ccccc2)(c2ccccc2)n2nc(-c3cccc(N4CCOCC4)n3)c3c(OC4CCOCC4)nccc32)cc1 |
| InChI | InChI=1S/C39H37N5O3/c1-4-11-29(12-5-1)39(30-13-6-2-7-14-30,31-15-8-3-9-16-31)44-34-19-22-40-38(47-32-20-25-45-26-21-32)36(34)37(42-44)33-17-10-18-35(41-33)43-23-27-46-28-24-43/h1-19,22,32H,20-21,23-28H2 |
| InChIKey | RAKWTASLPINGOE-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 74.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.76 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|