C36H31FN4O2 — CID 90400910
[6-fluoro-3-(2-morpholin-4-yl-4-pyridinyl)-1-tritylindazol-5-yl]methanol (PubChem CID 90400910) has the molecular formula C36H31FN4O2 and a molecular weight of 570.67 g/mol. Its IUPAC name is [6-fluoro-3-(2-morpholin-4-yl-4-pyridinyl)-1-tritylindazol-5-yl]methanol.
| Compound Name | [6-fluoro-3-(2-morpholin-4-yl-4-pyridinyl)-1-tritylindazol-5-yl]methanol |
|---|---|
| PubChem CID | 90400910 |
| Molecular Formula | C36H31FN4O2 |
| Molecular Weight | 570.67 g/mol |
| Exact Mass | 570.24 |
| IUPAC Name | [6-fluoro-3-(2-morpholin-4-yl-4-pyridinyl)-1-tritylindazol-5-yl]methanol |
| SMILES | OCc1cc2c(-c3ccnc(N4CCOCC4)c3)nn(C(c3ccccc3)(c3ccccc3)c3ccccc3)c2cc1F |
| InChI | InChI=1S/C36H31FN4O2/c37-32-24-33-31(22-27(32)25-42)35(26-16-17-38-34(23-26)40-18-20-43-21-19-40)39-41(33)36(28-10-4-1-5-11-28,29-12-6-2-7-13-29)30-14-8-3-9-15-30/h1-17,22-24,42H,18-21,25H2 |
| InChIKey | JYYSOYUKXYTKIP-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.67 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|