C19H18FN3O2 — CID 159734349
2-[6-fluoro-3-(2-morpholin-4-yl-4-pyridinyl)-1H-isoindol-5-yl]acetaldehyde (PubChem CID 159734349) has the molecular formula C19H18FN3O2 and a molecular weight of 339.37 g/mol. Its IUPAC name is 2-[6-fluoro-3-(2-morpholin-4-yl-4-pyridinyl)-1H-isoindol-5-yl]acetaldehyde.
| Compound Name | 2-[6-fluoro-3-(2-morpholin-4-yl-4-pyridinyl)-1H-isoindol-5-yl]acetaldehyde |
|---|---|
| PubChem CID | 159734349 |
| Molecular Formula | C19H18FN3O2 |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 2-[6-fluoro-3-(2-morpholin-4-yl-4-pyridinyl)-1H-isoindol-5-yl]acetaldehyde |
| SMILES | O=CCc1cc2c(cc1F)CN=C2c1ccnc(N2CCOCC2)c1 |
| InChI | InChI=1S/C19H18FN3O2/c20-17-10-15-12-22-19(16(15)9-13(17)2-6-24)14-1-3-21-18(11-14)23-4-7-25-8-5-23/h1,3,6,9-11H,2,4-5,7-8,12H2 |
| InChIKey | VTUZVSNWXPYYNZ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 54.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|