C24H31N5O — CID 157491720
4-[3-[4-[4-(3H-isoindol-1-yl)-2-pyridinyl]piperazin-1-yl]propyl]morpholine (PubChem CID 157491720) has the molecular formula C24H31N5O and a molecular weight of 405.55 g/mol. Its IUPAC name is 4-[3-[4-[4-(3H-isoindol-1-yl)-2-pyridinyl]piperazin-1-yl]propyl]morpholine.
| Compound Name | 4-[3-[4-[4-(3H-isoindol-1-yl)-2-pyridinyl]piperazin-1-yl]propyl]morpholine |
|---|---|
| PubChem CID | 157491720 |
| Molecular Formula | C24H31N5O |
| Molecular Weight | 405.55 g/mol |
| Exact Mass | 405.25 |
| IUPAC Name | 4-[3-[4-[4-(3H-isoindol-1-yl)-2-pyridinyl]piperazin-1-yl]propyl]morpholine |
| SMILES | c1ccc2c(c1)CN=C2c1ccnc(N2CCN(CCCN3CCOCC3)CC2)c1 |
| InChI | InChI=1S/C24H31N5O/c1-2-5-22-21(4-1)19-26-24(22)20-6-7-25-23(18-20)29-12-10-27(11-13-29)8-3-9-28-14-16-30-17-15-28/h1-2,4-7,18H,3,8-17,19H2 |
| InChIKey | BXIWFJIKSVCZSV-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 44.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.55 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |