C58H50F2N8O4 — CID 158201407
4-[4-[6-(2-fluoro-4-phenylmethoxy-3-pyridinyl)-3H-isoindol-1-yl]-2-pyridinyl]morpholine (PubChem CID 158201407) has the molecular formula C58H50F2N8O4 and a molecular weight of 961.09 g/mol. Its IUPAC name is 4-[4-[6-(2-fluoro-4-phenylmethoxy-3-pyridinyl)-3H-isoindol-1-yl]-2-pyridinyl]morpholine.
| Compound Name | 4-[4-[6-(2-fluoro-4-phenylmethoxy-3-pyridinyl)-3H-isoindol-1-yl]-2-pyridinyl]morpholine |
|---|---|
| PubChem CID | 158201407 |
| Molecular Formula | C58H50F2N8O4 |
| Molecular Weight | 961.09 g/mol |
| Exact Mass | 960.39 |
| IUPAC Name | 4-[4-[6-(2-fluoro-4-phenylmethoxy-3-pyridinyl)-3H-isoindol-1-yl]-2-pyridinyl]morpholine |
| SMILES | Fc1nccc(OCc2ccccc2)c1-c1ccc2c(c1)C(c1ccnc(N3CCOCC3)c1)=NC2.Fc1nccc(OCc2ccccc2)c1-c1ccc2c(c1)C(c1ccnc(N3CCOCC3)c1)=NC2 |
| InChI | InChI=1S/2C29H25FN4O2/c2*30-29-27(25(9-11-32-29)36-19-20-4-2-1-3-5-20)21-6-7-23-18-33-28(24(23)16-21)22-8-10-31-26(17-22)34-12-14-35-15-13-34/h2*1-11,16-17H,12-15,18-19H2 |
| InChIKey | GAZCMMOEDYHBHF-UHFFFAOYSA-N |
| XLogP | 10.10 |
| TPSA | 119.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 72 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 961.09 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|