C17H15N3O2Sn — CID 144697800
3-(2-morpholin-4-yl-4-pyridinyl)-2,1λ2-benzazastannole-5-carbaldehyde (PubChem CID 144697800) has the molecular formula C17H15N3O2Sn and a molecular weight of 412.04 g/mol. Its IUPAC name is 3-(2-morpholin-4-yl-4-pyridinyl)-2,1λ2-benzazastannole-5-carbaldehyde.
| Compound Name | 3-(2-morpholin-4-yl-4-pyridinyl)-2,1λ2-benzazastannole-5-carbaldehyde |
|---|---|
| PubChem CID | 144697800 |
| Molecular Formula | C17H15N3O2Sn |
| Molecular Weight | 412.04 g/mol |
| Exact Mass | 413.02 |
| IUPAC Name | 3-(2-morpholin-4-yl-4-pyridinyl)-2,1λ2-benzazastannole-5-carbaldehyde |
| SMILES | O=Cc1ccc2c(c1)C(c1ccnc(N3CCOCC3)c1)=N[Sn]2 |
| InChI | InChI=1S/C17H15N3O2.Sn/c18-17(14-3-1-2-13(10-14)12-21)15-4-5-19-16(11-15)20-6-8-22-9-7-20;/h1-2,4-5,10-12H,6-9H2;/q-1;+1 |
| InChIKey | KBKRPCOSFUKMLC-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 54.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.04 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|