C22H23N5O — CID 162152446
4-[4-[4-methyl-6-(1-methylpyrazol-4-yl)-3H-isoindol-1-yl]-2-pyridinyl]morpholine (PubChem CID 162152446) has the molecular formula C22H23N5O and a molecular weight of 373.46 g/mol. Its IUPAC name is 4-[4-[4-methyl-6-(1-methylpyrazol-4-yl)-3H-isoindol-1-yl]-2-pyridinyl]morpholine.
| Compound Name | 4-[4-[4-methyl-6-(1-methylpyrazol-4-yl)-3H-isoindol-1-yl]-2-pyridinyl]morpholine |
|---|---|
| PubChem CID | 162152446 |
| Molecular Formula | C22H23N5O |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | 4-[4-[4-methyl-6-(1-methylpyrazol-4-yl)-3H-isoindol-1-yl]-2-pyridinyl]morpholine |
| SMILES | Cc1cc(-c2cnn(C)c2)cc2c1CN=C2c1ccnc(N2CCOCC2)c1 |
| InChI | InChI=1S/C22H23N5O/c1-15-9-17(18-12-25-26(2)14-18)10-19-20(15)13-24-22(19)16-3-4-23-21(11-16)27-5-7-28-8-6-27/h3-4,9-12,14H,5-8,13H2,1-2H3 |
| InChIKey | ZLJVJYNZZHMWAR-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 55.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |