C28H30N4O — CID 11374021
N-(4-tert-butylphenyl)-4-(2-morpholin-4-yl-4-pyridinyl)isoquinolin-1-amine (PubChem CID 11374021) has the molecular formula C28H30N4O and a molecular weight of 438.58 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-4-(2-morpholin-4-yl-4-pyridinyl)isoquinolin-1-amine.
| Compound Name | N-(4-tert-butylphenyl)-4-(2-morpholin-4-yl-4-pyridinyl)isoquinolin-1-amine |
|---|---|
| PubChem CID | 11374021 |
| Molecular Formula | C28H30N4O |
| Molecular Weight | 438.58 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | N-(4-tert-butylphenyl)-4-(2-morpholin-4-yl-4-pyridinyl)isoquinolin-1-amine |
| SMILES | CC(C)(C)c1ccc(Nc2ncc(-c3ccnc(N4CCOCC4)c3)c3ccccc23)cc1 |
| InChI | InChI=1S/C28H30N4O/c1-28(2,3)21-8-10-22(11-9-21)31-27-24-7-5-4-6-23(24)25(19-30-27)20-12-13-29-26(18-20)32-14-16-33-17-15-32/h4-13,18-19H,14-17H2,1-3H3,(H,30,31) |
| InChIKey | RJARJEFTSIFPGX-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.58 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |