C24H36N2O2 — CID 165066762
1-tert-butyl-2-methoxybenzene;4-(4-tert-butyl-2-pyridinyl)morpholine (PubChem CID 165066762) has the molecular formula C24H36N2O2 and a molecular weight of 384.56 g/mol. Its IUPAC name is 1-tert-butyl-2-methoxybenzene;4-(4-tert-butyl-2-pyridinyl)morpholine.
| Compound Name | 1-tert-butyl-2-methoxybenzene;4-(4-tert-butyl-2-pyridinyl)morpholine |
|---|---|
| PubChem CID | 165066762 |
| Molecular Formula | C24H36N2O2 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.28 |
| IUPAC Name | 1-tert-butyl-2-methoxybenzene;4-(4-tert-butyl-2-pyridinyl)morpholine |
| SMILES | CC(C)(C)c1ccnc(N2CCOCC2)c1.COc1ccccc1C(C)(C)C |
| InChI | InChI=1S/C13H20N2O.C11H16O/c1-13(2,3)11-4-5-14-12(10-11)15-6-8-16-9-7-15;1-11(2,3)9-7-5-6-8-10(9)12-4/h4-5,10H,6-9H2,1-3H3;5-8H,1-4H3 |
| InChIKey | SCCDWSHYFGVJOA-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |