C40H37N5O2 — CID 71007805
4-(oxan-4-yloxy)-3-(3-propan-2-ylbenzimidazol-5-yl)-1-tritylpyrazolo[4,3-c]pyridine (PubChem CID 71007805) has the molecular formula C40H37N5O2 and a molecular weight of 619.77 g/mol. Its IUPAC name is 4-(oxan-4-yloxy)-3-(3-propan-2-ylbenzimidazol-5-yl)-1-tritylpyrazolo[4,3-c]pyridine.
| Compound Name | 4-(oxan-4-yloxy)-3-(3-propan-2-ylbenzimidazol-5-yl)-1-tritylpyrazolo[4,3-c]pyridine |
|---|---|
| PubChem CID | 71007805 |
| Molecular Formula | C40H37N5O2 |
| Molecular Weight | 619.77 g/mol |
| Exact Mass | 619.29 |
| IUPAC Name | 4-(oxan-4-yloxy)-3-(3-propan-2-ylbenzimidazol-5-yl)-1-tritylpyrazolo[4,3-c]pyridine |
| SMILES | CC(C)n1cnc2ccc(-c3nn(C(c4ccccc4)(c4ccccc4)c4ccccc4)c4ccnc(OC5CCOCC5)c34)cc21 |
| InChI | InChI=1S/C40H37N5O2/c1-28(2)44-27-42-34-19-18-29(26-36(34)44)38-37-35(20-23-41-39(37)47-33-21-24-46-25-22-33)45(43-38)40(30-12-6-3-7-13-30,31-14-8-4-9-15-31)32-16-10-5-11-17-32/h3-20,23,26-28,33H,21-22,24-25H2,1-2H3 |
| InChIKey | DBQBICMYSMIWJN-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 66.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.77 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|