C52H38Cl2I2N6 — CID 161431757
6-chloro-3-iodo-4-methyl-1-tritylpyrazolo[4,3-c]pyridine (PubChem CID 161431757) has the molecular formula C52H38Cl2I2N6 and a molecular weight of 1071.63 g/mol. Its IUPAC name is 6-chloro-3-iodo-4-methyl-1-tritylpyrazolo[4,3-c]pyridine.
| Compound Name | 6-chloro-3-iodo-4-methyl-1-tritylpyrazolo[4,3-c]pyridine |
|---|---|
| PubChem CID | 161431757 |
| Molecular Formula | C52H38Cl2I2N6 |
| Molecular Weight | 1071.63 g/mol |
| Exact Mass | 1070.06 |
| IUPAC Name | 6-chloro-3-iodo-4-methyl-1-tritylpyrazolo[4,3-c]pyridine |
| SMILES | Cc1nc(Cl)cc2c1c(I)nn2C(c1ccccc1)(c1ccccc1)c1ccccc1.Cc1nc(Cl)cc2c1c(I)nn2C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/2C26H19ClIN3/c2*1-18-24-22(17-23(27)29-18)31(30-25(24)28)26(19-11-5-2-6-12-19,20-13-7-3-8-14-20)21-15-9-4-10-16-21/h2*2-17H,1H3 |
| InChIKey | VYCJUIHGXJOMMD-UHFFFAOYSA-N |
| XLogP | 13.68 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1071.63 |
| LogP ≤ 5 | 13.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|