C26H22IN5 — CID 135372917
3-iodo-N,N-dimethyl-1-tritylpyrazolo[5,4-d]pyrimidin-4-amine (PubChem CID 135372917) has the molecular formula C26H22IN5 and a molecular weight of 531.40 g/mol. Its IUPAC name is 3-iodo-N,N-dimethyl-1-tritylpyrazolo[5,4-d]pyrimidin-4-amine.
| Compound Name | 3-iodo-N,N-dimethyl-1-tritylpyrazolo[5,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 135372917 |
| Molecular Formula | C26H22IN5 |
| Molecular Weight | 531.40 g/mol |
| Exact Mass | 531.09 |
| IUPAC Name | 3-iodo-N,N-dimethyl-1-tritylpyrazolo[5,4-d]pyrimidin-4-amine |
| SMILES | CN(C)c1ncnc2c1c(I)nn2C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H22IN5/c1-31(2)24-22-23(27)30-32(25(22)29-18-28-24)26(19-12-6-3-7-13-19,20-14-8-4-9-15-20)21-16-10-5-11-17-21/h3-18H,1-2H3 |
| InChIKey | FUQQKFYQNVNKNW-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.40 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|